EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H50O6 |
| Net Charge | 0 |
| Average Mass | 602.812 |
| Monoisotopic Mass | 602.36074 |
| SMILES | CC(C)=CCC[C@]1(C)[C@@H](CC=C(C)C)C[C@]2(CC=C(C)C)C(=O)[C@@]1(CC=C(C)C)C(=O)C(C(=O)c1ccc(O)c(O)c1)=C2O |
| InChI | InChI=1S/C38H50O6/c1-23(2)11-10-18-36(9)28(14-12-24(3)4)22-37(19-16-25(5)6)33(42)31(32(41)27-13-15-29(39)30(40)21-27)34(43)38(36,35(37)44)20-17-26(7)8/h11-13,15-17,21,28,39-40,42H,10,14,18-20,22H2,1-9H3/t28-,36+,37-,38+/m0/s1 |
| InChIKey | QKKRBNPMUBNTPA-GHCWVHGPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Garcinia livingstonei (ncbitaxon:469932) | fruit (BTO:0000486) | DOI (10.1016/S0040-4020(01)89039-6) | |
| Symphonia globulifera (ncbitaxon:156483) | |||
| leaf (BTO:0000713) | PubMed (17960072) | ||
| root (BTO:0001188) | PubMed (17960072) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Guttiferone A (rel-(+)) (CHEBI:65990) has role metabolite (CHEBI:25212) |
| Guttiferone A (rel-(+)) (CHEBI:65990) is a monoterpenoid (CHEBI:25409) |
| Citations |
|---|