EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H23NO4 |
| Net Charge | 0 |
| Average Mass | 317.385 |
| Monoisotopic Mass | 317.16271 |
| SMILES | [H][C@@]12c3cc(OC)c(OC)cc3[C@@H](O)O[C@]1([H])CC=C1CCN(C)[C@]12[H] |
| InChI | InChI=1S/C18H23NO4/c1-19-7-6-10-4-5-13-16(17(10)19)11-8-14(21-2)15(22-3)9-12(11)18(20)23-13/h4,8-9,13,16-18,20H,5-7H2,1-3H3/t13-,16-,17-,18+/m1/s1 |
| InChIKey | VHYYSQODIQWPDO-PILAGYSTSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lycorenine (CHEBI:6599) is a alkaloid (CHEBI:22315) |
| Synonym | Source |
|---|---|
| Lycorenine | KEGG COMPOUND |