EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H24O8 |
| Net Charge | 0 |
| Average Mass | 476.481 |
| Monoisotopic Mass | 476.14712 |
| SMILES | CC1=C[C@@H](c2cc(C=O)c(O)cc2O)[C@H](C(=O)c2ccc(O)cc2O)[C@@H](c2ccc(O)cc2O)C1 |
| InChI | InChI=1S/C27H24O8/c1-13-6-20(17-4-2-15(29)9-23(17)32)26(27(35)18-5-3-16(30)10-24(18)33)21(7-13)19-8-14(12-28)22(31)11-25(19)34/h2-5,7-12,20-21,26,29-34H,6H2,1H3/t20-,21+,26-/m1/s1 |
| InChIKey | QCPFZAFDSWGNMR-YZIHRLCOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Morus macroura (ncbitaxon:191188) | stem (BTO:0001300) | PubMed (15467233) | Previous component: stem bark; |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guangsangon L (CHEBI:65983) has role antioxidant (CHEBI:22586) |
| guangsangon L (CHEBI:65983) has role plant metabolite (CHEBI:76924) |
| guangsangon L (CHEBI:65983) is a aromatic ketone (CHEBI:76224) |
| guangsangon L (CHEBI:65983) is a dihydroxybenzaldehyde (CHEBI:50196) |
| guangsangon L (CHEBI:65983) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 5-[(1R,5S,6R)-6-(2,4-dihydroxybenzoyl)-5-(2,4-dihydroxyphenyl)-3-methylcyclohex-2-en-1-yl]-2,4-dihydroxybenzaldehyde |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9886201 | Reaxys |
| Citations |
|---|