EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H30O11 |
| Net Charge | 0 |
| Average Mass | 626.614 |
| Monoisotopic Mass | 626.17881 |
| SMILES | CC1=C[C@@H](c2c(O)ccc([C@H]3Oc4cc(O)ccc4C(=O)[C@@H]3O)c2O)[C@H](C(=O)c2ccc(O)cc2O)[C@@H](c2ccc(O)cc2O)C1 |
| InChI | InChI=1S/C35H30O11/c1-15-10-23(19-5-2-16(36)12-26(19)40)29(31(42)20-6-3-17(37)13-27(20)41)24(11-15)30-25(39)9-8-22(32(30)43)35-34(45)33(44)21-7-4-18(38)14-28(21)46-35/h2-9,11-14,23-24,29,34-41,43,45H,10H2,1H3/t23-,24-,29-,34+,35-/m1/s1 |
| InChIKey | XFBBWTUEALDZHM-IZJPYPARSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Morus macroura (ncbitaxon:191188) | stem (BTO:0001300) | PubMed (15467233) | Previous component: stem bark; |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guangsangon K (CHEBI:65982) has role antioxidant (CHEBI:22586) |
| guangsangon K (CHEBI:65982) has role plant metabolite (CHEBI:76924) |
| guangsangon K (CHEBI:65982) is a aromatic ketone (CHEBI:76224) |
| guangsangon K (CHEBI:65982) is a dihydroflavonols (CHEBI:48039) |
| guangsangon K (CHEBI:65982) is a polyphenol (CHEBI:26195) |
| guangsangon K (CHEBI:65982) is a secondary α-hydroxy ketone (CHEBI:2468) |
| IUPAC Name |
|---|
| (2R,3R)-2-{3-[(1R,5S,6R)-6-(2,4-dihydroxybenzoyl)-5-(2,4-dihydroxyphenyl)-3-methylcyclohex-2-en-1-yl]-2,4-dihydroxyphenyl}-3,7-dihydroxy-2,3-dihydro-4H-chromen-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9891559 | Reaxys |
| Citations |
|---|