EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14O4 |
| Net Charge | 0 |
| Average Mass | 234.251 |
| Monoisotopic Mass | 234.08921 |
| SMILES | CC(=O)c1c(O)cc2c(c1C)C(=O)CC(O)C2 |
| InChI | InChI=1S/C13H14O4/c1-6-12(7(2)14)10(16)4-8-3-9(15)5-11(17)13(6)8/h4,9,15-16H,3,5H2,1-2H3 |
| InChIKey | ODXUROYZJHIZHE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Micromonospora (ncbitaxon:1873) | - | PubMed (9917009) | Strain: SA246 |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GTRI-02 (CHEBI:65981) has role antioxidant (CHEBI:22586) |
| GTRI-02 (CHEBI:65981) has role metabolite (CHEBI:25212) |
| GTRI-02 (CHEBI:65981) is a aromatic ketone (CHEBI:76224) |
| GTRI-02 (CHEBI:65981) is a cyclic ketone (CHEBI:3992) |
| GTRI-02 (CHEBI:65981) is a methyl ketone (CHEBI:51867) |
| GTRI-02 (CHEBI:65981) is a phenols (CHEBI:33853) |
| GTRI-02 (CHEBI:65981) is a secondary alcohol (CHEBI:35681) |
| GTRI-02 (CHEBI:65981) is a tetralins (CHEBI:36786) |
| IUPAC Name |
|---|
| 7-acetyl-3,6-dihydroxy-8-methyl-3,4-dihydronaphthalen-1(2H)-one |
| Synonym | Source |
|---|---|
| 7-acetyl-3,6-dihydroxy-8-methyl-tetralone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8151628 | Reaxys |
| Citations |
|---|