EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C56H79N9O10S2 |
| Net Charge | 0 |
| Average Mass | 1102.435 |
| Monoisotopic Mass | 1101.53913 |
| SMILES | [H][C@]1([C@@H](C)O)NC(=O)[C@@H](CC(C)C)N(C)C(=O)[C@]2([H])CSC(=N2)[C@@H](CC)NC(=O)[C@]2([H])CSC(=N2)[C@@H](Cc2ccccc2)N(C)C(=O)[C@]2([H])CCCN2C(=O)[C@H](C(C)C)N(C)C(=O)[C@H](Cc2ccccc2)OC(=O)[C@H](C)[C@@H](C)NC1=O |
| InChI | InChI=1S/C56H79N9O10S2/c1-12-38-50-60-40(30-76-50)52(70)62(9)42(26-31(2)3)48(68)61-45(35(8)66)49(69)57-34(7)33(6)56(74)75-44(28-37-22-17-14-18-23-37)54(72)64(11)46(32(4)5)55(73)65-25-19-24-41(65)53(71)63(10)43(27-36-20-15-13-16-21-36)51-59-39(29-77-51)47(67)58-38/h13-18,20-23,31-35,38-46,66H,12,19,24-30H2,1-11H3,(H,57,69)(H,58,67)(H,61,68)/t33-,34-,35-,38-,39+,40+,41+,42-,43-,44+,45-,46+/m1/s1 |
| InChIKey | KUUZFDUZAFJFSJ-IHTUVIFUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lyngbya confervoides (ncbitaxon:207921) | - | PubMed (18220404) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| grassypeptolide (CHEBI:65980) has role antineoplastic agent (CHEBI:35610) |
| grassypeptolide (CHEBI:65980) has role metabolite (CHEBI:25212) |
| grassypeptolide (CHEBI:65980) is a cyclodepsipeptide (CHEBI:35213) |
| grassypeptolide (CHEBI:65980) is a macrocycle (CHEBI:51026) |
| IUPAC Name |
|---|
| (3R,7R,10R,14R,17R,20R,23R,24R,27S,30S,35aS)-3,27-dibenzyl-10-ethyl-20-[(1R)-1-hydroxyethyl]-2,16,23,24,29-pentamethyl-17-(2-methylpropyl)-30-(propan-2-yl)hexadecahydro-1H,6H,13H,27H-7,4:14,11-di(azeno)pyrrolo[1,2-g][1,13,20,4,7,10,17,24,27,30]oxadithiaheptaazacyclotritriacontine-1,8,15,18,21,25,28,31(7H,14H,22H)-octone |
| Manual Xrefs | Databases |
|---|---|
| 24600256 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18860639 | Reaxys |
| Citations |
|---|