EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O8 |
| Net Charge | 0 |
| Average Mass | 402.399 |
| Monoisotopic Mass | 402.13147 |
| SMILES | [H][C@@]12CO[C@@H](c3cc(O)cc(OC)c3)[C@]1([H])C(=O)O[C@H]2c1cc(O)c(OC)c(OC)c1 |
| InChI | InChI=1S/C21H22O8/c1-25-13-5-10(4-12(22)8-13)19-17-14(9-28-19)18(29-21(17)24)11-6-15(23)20(27-3)16(7-11)26-2/h4-8,14,17-19,22-23H,9H2,1-3H3/t14-,17-,18+,19+/m1/s1 |
| InChIKey | JTDVCRMQMDJLOR-OAOYMFHYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Imperata cylindrica (ncbitaxon:80369) | rhizome (BTO:0001181) | PubMed (7714541) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| graminone B (CHEBI:65979) has role metabolite (CHEBI:25212) |
| graminone B (CHEBI:65979) has role vasodilator agent (CHEBI:35620) |
| graminone B (CHEBI:65979) is a lignan (CHEBI:25036) |
| graminone B (CHEBI:65979) is a methoxybenzenes (CHEBI:51683) |
| graminone B (CHEBI:65979) is a phenols (CHEBI:33853) |
| graminone B (CHEBI:65979) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3R,3aS,6R,6aR)-3-(3-hydroxy-4,5-dimethoxyphenyl)-6-(3-hydroxy-5-methoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan-1-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22818843 | Reaxys |
| Citations |
|---|