EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H18O5 |
| Net Charge | 0 |
| Average Mass | 350.370 |
| Monoisotopic Mass | 350.11542 |
| SMILES | COc1cc(O)cc2c1-c1oc3c4c(ccc3c1CO2)OC(C)(C)C=C4 |
| InChI | InChI=1S/C21H18O5/c1-21(2)7-6-13-15(26-21)5-4-12-14-10-24-17-9-11(22)8-16(23-3)18(17)20(14)25-19(12)13/h4-9,22H,10H2,1-3H3 |
| InChIKey | BKLGAGSBCOUJGV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycyrrhiza uralensis (ncbitaxon:74613) | root (BTO:0001188) | PubMed (16441081) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycyrrhizol B (CHEBI:65977) has role antibacterial agent (CHEBI:33282) |
| glycyrrhizol B (CHEBI:65977) has role metabolite (CHEBI:25212) |
| glycyrrhizol B (CHEBI:65977) is a ether (CHEBI:25698) |
| glycyrrhizol B (CHEBI:65977) is a organic heteropentacyclic compound (CHEBI:38164) |
| glycyrrhizol B (CHEBI:65977) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 12-methoxy-3,3-dimethyl-3H,7H-furo[3,2-c:5,4-f']dichromen-10-ol |
| Synonym | Source |
|---|---|
| 7-hydroxy-5-methoxy-2'',2''-dimethyl-2H-pyrano[3',4',5'',6'']-pterocarpene | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18589783 | Reaxys |
| Citations |
|---|