EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H28O5 |
| Net Charge | 0 |
| Average Mass | 420.505 |
| Monoisotopic Mass | 420.19367 |
| SMILES | COc1c(CC=C(C)C)c(O)cc2c1-c1oc3cc(O)c(CC=C(C)C)cc3c1CO2 |
| InChI | InChI=1S/C26H28O5/c1-14(2)6-8-16-10-18-19-13-30-23-12-21(28)17(9-7-15(3)4)25(29-5)24(23)26(19)31-22(18)11-20(16)27/h6-7,10-12,27-28H,8-9,13H2,1-5H3 |
| InChIKey | CBPFOSMNDISZLV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycyrrhiza uralensis (ncbitaxon:74613) | root (BTO:0001188) | PubMed (16441081) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycyrrhizol A (CHEBI:65976) has role antibacterial agent (CHEBI:33282) |
| glycyrrhizol A (CHEBI:65976) has role plant metabolite (CHEBI:76924) |
| glycyrrhizol A (CHEBI:65976) is a aromatic ether (CHEBI:35618) |
| glycyrrhizol A (CHEBI:65976) is a coumestans (CHEBI:72577) |
| glycyrrhizol A (CHEBI:65976) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 1-methoxy-2,8-bis(3-methylbut-2-en-1-yl)-6H-[1]benzofuro[3,2-c]chromene-3,9-diol |
| Synonym | Source |
|---|---|
| 7,4'-dihydroxy-5-methoxy-6,5'-di(3,3-dimethylallyl)-pterocarpene | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Glycyrrhizol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18589784 | Reaxys |
| Citations |
|---|