EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H45O6.Na |
| Net Charge | 0 |
| Average Mass | 536.685 |
| Monoisotopic Mass | 536.31138 |
| SMILES | [H][C@@]12CC(=O)/C(=C(C)\C=C\C=C(C)\C=C\C(OC)C(C)(C)O)[C@@]1(C)CC[C@]1([H])[C@]2(C)CC[C@@H](O)[C@]1(C)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C31H46O6.Na/c1-19(12-13-25(37-8)28(3,4)36)10-9-11-20(2)26-21(32)18-23-29(5)17-15-24(33)31(7,27(34)35)22(29)14-16-30(23,26)6;/h9-13,22-25,33,36H,14-18H2,1-8H3,(H,34,35);/q;+1/p-1/b11-9+,13-12+,19-10+,26-20+;/t22-,23+,24-,25?,29+,30+,31-;/m1./s1 |
| InChIKey | CERBHPPRQFHGMC-PULODHPASA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stelletta globostellata (WORMS:194014) | - | PubMed (8778241) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium globostellatate D (CHEBI:65972) has part globostellatate D(1−) (CHEBI:72309) |
| sodium globostellatate D (CHEBI:65972) has role antineoplastic agent (CHEBI:35610) |
| sodium globostellatate D (CHEBI:65972) has role metabolite (CHEBI:25212) |
| sodium globostellatate D (CHEBI:65972) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium (3Z,3aS,5aR,6R,7R,9aR,9bS)-7-hydroxy-3-[(3E,5E,7E)-10-hydroxy-9-methoxy-6,10-dimethylundeca-3,5,7-trien-2-ylidene]-3a,6,9a-trimethyl-2-oxododecahydro-1H-cyclopenta[a]naphthalene-6-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 10476144 | ChemSpider |
| Citations |
|---|