EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21N3O4S |
| Net Charge | 0 |
| Average Mass | 363.439 |
| Monoisotopic Mass | 363.12528 |
| SMILES | CO[C@]1(Cc2cnc3ccccc23)NC(=O)[C@@](SC)([C@@H](C)O)NC1=O |
| InChI | InChI=1S/C17H21N3O4S/c1-10(21)17(25-3)15(23)19-16(24-2,14(22)20-17)8-11-9-18-13-7-5-4-6-12(11)13/h4-7,9-10,18,21H,8H2,1-3H3,(H,19,23)(H,20,22)/t10-,16+,17+/m1/s1 |
| InChIKey | XBAWMOXUPDFOKQ-YKJXYISPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bionectria byssicola (ncbitaxon:160290) | - | PubMed (17690474) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glioperazine B (CHEBI:65968) has role metabolite (CHEBI:25212) |
| glioperazine B (CHEBI:65968) is a 2,5-diketopiperazines (CHEBI:65061) |
| glioperazine B (CHEBI:65968) is a ether (CHEBI:25698) |
| glioperazine B (CHEBI:65968) is a indoles (CHEBI:24828) |
| glioperazine B (CHEBI:65968) is a organic sulfide (CHEBI:16385) |
| IUPAC Name |
|---|
| (3S,6S)-3-[(1R)-1-hydroxyethyl]-6-(1H-indol-3-ylmethyl)-6-methoxy-3-(methylsulfanyl)piperazine-2,5-dione |
| Manual Xrefs | Databases |
|---|---|
| 10480064 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11195587 | Reaxys |
| Citations |
|---|