EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H11N3O5S2 |
| Net Charge | 0 |
| Average Mass | 353.381 |
| Monoisotopic Mass | 353.01401 |
| SMILES | CN1C(=O)[C@@]23Cc4ccc([N+](=O)[O-])cc4N2C(=O)[C@]1(CO)SS3 |
| InChI | InChI=1S/C13H11N3O5S2/c1-14-10(18)12-5-7-2-3-8(16(20)21)4-9(7)15(12)11(19)13(14,6-17)23-22-12/h2-4,17H,5-6H2,1H3/t12-,13-/m0/s1 |
| InChIKey | VRFJINVAZRAFHH-STQMWFEESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus fumigatus (ncbitaxon:746128) | - | PubMed (19159274) | Strain: KMC 901 |
| Sphingomonas sp. (ncbitaxon:28214) | - | PubMed (19159274) | Strain: KMK-001 |
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glionitrin A (CHEBI:65967) has role Aspergillus metabolite (CHEBI:76956) |
| glionitrin A (CHEBI:65967) has role antimicrobial agent (CHEBI:33281) |
| glionitrin A (CHEBI:65967) has role antineoplastic agent (CHEBI:35610) |
| glionitrin A (CHEBI:65967) is a C-nitro compound (CHEBI:35716) |
| glionitrin A (CHEBI:65967) is a organic disulfide (CHEBI:35489) |
| glionitrin A (CHEBI:65967) is a organic heterotetracyclic compound (CHEBI:38163) |
| glionitrin A (CHEBI:65967) is a pyrazinoindole (CHEBI:64130) |
| IUPAC Name |
|---|
| (3S,10aS)-3-(hydroxymethyl)-2-methyl-7-nitro-2,3-dihydro-10H-3,10a-epidithiopyrazino[1,2-a]indole-1,4-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19154490 | Reaxys |
| CAS:1116153-15-1 | Reaxys |
| Citations |
|---|