EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11ClN4O |
| Net Charge | 0 |
| Average Mass | 190.634 |
| Monoisotopic Mass | 190.06214 |
| SMILES | NC[C@H](Cl)[C@@H](O)c1cnc(N)n1 |
| InChI | InChI=1S/C6H11ClN4O/c7-3(1-8)5(12)4-2-10-6(9)11-4/h2-3,5,12H,1,8H2,(H3,9,10,11)/t3-,5+/m0/s1 |
| InChIKey | YILCGOCHVFQMTC-WVZVXSGGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Axinella brevistyla (WORMS:12958) | - | PubMed (11754618) | |
| Cymbastela cantharella (ncbitaxon:798309) | - | Article (C R ACAD SCI PARIS 2, 307, 145) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| girolline (CHEBI:65966) has role metabolite (CHEBI:25212) |
| girolline (CHEBI:65966) is a aralkylamine (CHEBI:18000) |
| Synonym | Source |
|---|---|
| (alpha-S)-2-Amino-alpha-((1S)-2-amino-1-chloroethyl)imidazole-4-methanol | ChEBI |
| Citations |
|---|