EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H34N6O8 |
| Net Charge | 0 |
| Average Mass | 702.724 |
| Monoisotopic Mass | 702.24381 |
| SMILES | COc1c(O)c2c(c3cc(C(=O)N4CCc5c4c(O)c(OC)c4nc(C(=O)N6CC7CC78C6=CC(=O)c6ncc(C)c68)cc54)nc13)CCN2C(C)=O |
| InChI | InChI=1S/C38H34N6O8/c1-15-13-39-29-24(46)11-25-38(26(15)29)12-17(38)14-44(25)37(50)23-10-21-19-6-8-43(31(19)33(48)35(52-4)28(21)41-23)36(49)22-9-20-18-5-7-42(16(2)45)30(18)32(47)34(51-3)27(20)40-22/h9-11,13,17,39-41,47-48H,5-8,12,14H2,1-4H3 |
| InChIKey | XUBJLJZOSKJNMY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (10348041) | Strain: QM16 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gilvusmycin (CHEBI:65964) has role antimicrobial agent (CHEBI:33281) |
| gilvusmycin (CHEBI:65964) has role antineoplastic agent (CHEBI:35610) |
| gilvusmycin (CHEBI:65964) has role metabolite (CHEBI:25212) |
| gilvusmycin (CHEBI:65964) is a aromatic ether (CHEBI:35618) |
| gilvusmycin (CHEBI:65964) is a bridged compound (CHEBI:35990) |
| gilvusmycin (CHEBI:65964) is a cyclic ketone (CHEBI:3992) |
| gilvusmycin (CHEBI:65964) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| gilvusmycin (CHEBI:65964) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 6-({6-[(6-acetyl-5-hydroxy-4-methoxy-3,6,7,8-tetrahydropyrrolo[3,2-e]indol-2-yl)carbonyl]-5-hydroxy-4-methoxy-3,6,7,8-tetrahydropyrrolo[3,2-e]indol-2-yl}carbonyl)-3-methyl-4,4a,5,6-tetrahydrocyclopropa[c]pyrrolo[3,2-e]indol-8(1H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8382539 | Reaxys |
| Citations |
|---|