EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H66O6 |
| Net Charge | 0 |
| Average Mass | 606.929 |
| Monoisotopic Mass | 606.48594 |
| SMILES | [H][C@@]1([C@@H](O)CC[C@@H](O)[C@H](O)CC/C=C\CCCCCCCCCCCC)CC[C@@H](CCCCCCCC2=C[C@H](C)OC2=O)O1 |
| InChI | InChI=1S/C37H66O6/c1-3-4-5-6-7-8-9-10-11-12-13-14-18-21-24-33(38)34(39)26-27-35(40)36-28-25-32(43-36)23-20-17-15-16-19-22-31-29-30(2)42-37(31)41/h14,18,29-30,32-36,38-40H,3-13,15-17,19-28H2,1-2H3/b18-14-/t30-,32+,33+,34+,35-,36-/m0/s1 |
| InChIKey | HASWAOYLTAODRS-VKJZEEHVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Goniothalamus giganteus (ncbitaxon:261092) | bark (BTO:0001301) | PubMed (1479382) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gigantrionenin (CHEBI:65963) has role antineoplastic agent (CHEBI:35610) |
| gigantrionenin (CHEBI:65963) has role plant metabolite (CHEBI:76924) |
| gigantrionenin (CHEBI:65963) is a butenolide (CHEBI:50523) |
| gigantrionenin (CHEBI:65963) is a oxolanes (CHEBI:26912) |
| gigantrionenin (CHEBI:65963) is a polyketide (CHEBI:26188) |
| gigantrionenin (CHEBI:65963) is a secondary alcohol (CHEBI:35681) |
| gigantrionenin (CHEBI:65963) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (5S)-5-methyl-3-(7-{(2R,5S)-5-[(1S,4R,5R,8Z)-1,4,5-trihydroxyhenicos-8-en-1-yl]tetrahydrofuran-2-yl}heptyl)furan-2(5H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7630200 | Reaxys |
| Citations |
|---|