EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H66O7 |
| Net Charge | 0 |
| Average Mass | 622.928 |
| Monoisotopic Mass | 622.48085 |
| SMILES | CCCCCCCCCCCC/C=C\CCC(O)C(O)CCC(O)C1CCC(CCCCCC(O)CC2=CC(C)OC2=O)O1 |
| InChI | InChI=1S/C37H66O7/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-19-22-33(39)34(40)24-25-35(41)36-26-23-32(44-36)21-18-16-17-20-31(38)28-30-27-29(2)43-37(30)42/h14-15,27,29,31-36,38-41H,3-13,16-26,28H2,1-2H3/b15-14- |
| InChIKey | LFIZQGRMDGWRQH-PFONDFGASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Goniothalamus giganteus (ncbitaxon:261092) | bark (BTO:0001301) | PubMed (1479382) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gigantetronenin (CHEBI:65962) has role antineoplastic agent (CHEBI:35610) |
| gigantetronenin (CHEBI:65962) has role plant metabolite (CHEBI:76924) |
| gigantetronenin (CHEBI:65962) is a butenolide (CHEBI:50523) |
| gigantetronenin (CHEBI:65962) is a oxolanes (CHEBI:26912) |
| gigantetronenin (CHEBI:65962) is a polyketide (CHEBI:26188) |
| gigantetronenin (CHEBI:65962) is a secondary alcohol (CHEBI:35681) |
| gigantetronenin (CHEBI:65962) is a tetrol (CHEBI:33573) |
| IUPAC Name |
|---|
| 3-(2-hydroxy-7-{5-[(8Z)-1,4,5-trihydroxyhenicos-8-en-1-yl]tetrahydrofuran-2-yl}heptyl)-5-methylfuran-2(5H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6832033 | Reaxys |
| CAS:145403-31-2 | ChemIDplus |
| Citations |
|---|