EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O |
| Net Charge | 0 |
| Average Mass | 286.459 |
| Monoisotopic Mass | 286.22967 |
| SMILES | [H][C@]12CC/C(C)=C/CCC(=C)[C@]1([H])C[C@]2(C)C(=O)CC=C(C)C |
| InChI | InChI=1S/C20H30O/c1-14(2)9-12-19(21)20(5)13-17-16(4)8-6-7-15(3)10-11-18(17)20/h7,9,17-18H,4,6,8,10-13H2,1-3,5H3/b15-7+/t17-,18-,20-/m0/s1 |
| InChIKey | YRSZRXAWRABNPZ-SVLWDQMVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sinularia gibberosa (WORMS:288527) | - | PubMed (17917291) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gibberosin L (CHEBI:65961) has role antineoplastic agent (CHEBI:35610) |
| gibberosin L (CHEBI:65961) has role metabolite (CHEBI:25212) |
| gibberosin L (CHEBI:65961) is a diterpenoid (CHEBI:23849) |
| gibberosin L (CHEBI:65961) is a ketone (CHEBI:17087) |
| IUPAC Name |
|---|
| 1-[(1R*,5E,9S*,10S*)-6,10-dimethyl-2-methylidenebicyclo[7.2.0]undec-5-en-10-yl]-4-methylpent-3-en-1-one |
| Synonym | Source |
|---|---|
| (1S*,9R*,11S*,4E)-xeniaphylla-4,8(19),14-trien-12-one | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 23076671 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11209791 | Reaxys |
| Citations |
|---|