EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O2 |
| Net Charge | 0 |
| Average Mass | 302.458 |
| Monoisotopic Mass | 302.22458 |
| SMILES | [H][C@]12CC/C(C)=C/CCC(=C)[C@]1([H])C[C@]2(C)C(=O)/C=C/C(C)(C)O |
| InChI | InChI=1S/C20H30O2/c1-14-7-6-8-15(2)16-13-20(5,17(16)10-9-14)18(21)11-12-19(3,4)22/h7,11-12,16-17,22H,2,6,8-10,13H2,1,3-5H3/b12-11+,14-7+/t16-,17-,20-/m0/s1 |
| InChIKey | HFOYWBKBWBSCMJ-CNEVOPABSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sinularia gibberosa (WORMS:288527) | - | PubMed (17917291) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gibberosin K (CHEBI:65960) has role antineoplastic agent (CHEBI:35610) |
| gibberosin K (CHEBI:65960) has role metabolite (CHEBI:25212) |
| gibberosin K (CHEBI:65960) is a diterpenoid (CHEBI:23849) |
| gibberosin K (CHEBI:65960) is a ketone (CHEBI:17087) |
| gibberosin K (CHEBI:65960) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (2E)-1-[(1R*,5E,9S*,10S*)-6,10-dimethyl-2-methylidenebicyclo[7.2.0]undec-5-en-10-yl]-4-hydroxy-4-methylpent-2-en-1-one |
| Synonym | Source |
|---|---|
| (1S*,9R*,11S*,4E,13E)-15-hydroxyxeniphylla-4,8(19),13-trien-12 one | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 23076670 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11209790 | Reaxys |
| Citations |
|---|