EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O5 |
| Net Charge | 0 |
| Average Mass | 486.693 |
| Monoisotopic Mass | 486.33452 |
| SMILES | [H][C@]12C=CC(C[C@@]3(C(C)=O)CC[C@@]4([H])C(C)(C)[C@@H](O)[C@H](O)C[C@]4(C)[C@H]3C)=C[C@@]1(C)CCC[C@@]2(C)C(=O)O |
| InChI | InChI=1S/C30H46O5/c1-18-29(7)17-21(32)24(33)26(3,4)22(29)11-14-30(18,19(2)31)16-20-9-10-23-27(5,15-20)12-8-13-28(23,6)25(34)35/h9-10,15,18,21-24,32-33H,8,11-14,16-17H2,1-7H3,(H,34,35)/t18-,21-,22+,23+,24+,27-,28-,29-,30+/m1/s1 |
| InChIKey | JYKBQWDGVKFSAL-FAPPRUROSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Geum japonicum (ncbitaxon:321607) | whole plant (BTO:0001461) | PubMed (10993241) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. HIV protease inhibitor An inhibitor of HIV protease, an enzyme required for production of proteins needed for viral assembly. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| geumonoid (CHEBI:65959) has role HIV protease inhibitor (CHEBI:35660) |
| geumonoid (CHEBI:65959) has role metabolite (CHEBI:25212) |
| geumonoid (CHEBI:65959) is a methyl ketone (CHEBI:51867) |
| geumonoid (CHEBI:65959) is a monocarboxylic acid (CHEBI:25384) |
| geumonoid (CHEBI:65959) is a secondary alcohol (CHEBI:35681) |
| geumonoid (CHEBI:65959) is a triterpenoid (CHEBI:36615) |
| Synonym | Source |
|---|---|
| (1R,4aR,8aS)-6-{[(1R,2S,4aR,6R,7R,8aR)-2-acetyl-6,7-dihydroxy-1,5,5,8a-tetramethyldecahydronaphthalen-2-yl]methyl}-1,4a-dimethyl-1,2,3,4,4a,8a-hexahydronaphthalene-1-carboxylic acid | IUPAC |
| Citations |
|---|