EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30O7 |
| Net Charge | 0 |
| Average Mass | 430.497 |
| Monoisotopic Mass | 430.19915 |
| SMILES | [H][C@@]12C[C@@]3([H])OC(=O)C(C)=C3[C@@]3([H])O[C@@]13[C@@H](OC(C)=O)C[C@]1([H])C(C)(C)C=C[C@@H](OC(C)=O)[C@@]21C |
| InChI | InChI=1S/C24H30O7/c1-11-19-14(30-21(11)27)9-16-23(6)15(22(4,5)8-7-17(23)28-12(2)25)10-18(29-13(3)26)24(16)20(19)31-24/h7-8,14-18,20H,9-10H2,1-6H3/t14-,15-,16+,17-,18+,20-,23-,24-/m1/s1 |
| InChIKey | ZHVJRNZAMURVAT-UGFIOAGRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gelonium aequoreum (IPNI:349172-1) | leaf (BTO:0000713) | PubMed (17714747) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gelomulide M (CHEBI:65956) has role antineoplastic agent (CHEBI:35610) |
| gelomulide M (CHEBI:65956) has role metabolite (CHEBI:25212) |
| gelomulide M (CHEBI:65956) is a abietane diterpenoid (CHEBI:36762) |
| gelomulide M (CHEBI:65956) is a acetate ester (CHEBI:47622) |
| gelomulide M (CHEBI:65956) is a epoxide (CHEBI:32955) |
| gelomulide M (CHEBI:65956) is a organic heteropentacyclic compound (CHEBI:38164) |
| gelomulide M (CHEBI:65956) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (1β,5β,7β,9β,10α,12β,14β)-16-oxo-8,14:12,16-diepoxyabieta-2,13(15)-diene-1,7-diyl diacetate |
| Synonym | Source |
|---|---|
| 1β,7β-diacetoxy-8β,14β-epoxy-ent-abieta-2(3),13(15)-diene-16,12-olide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15836698 | Reaxys |
| Citations |
|---|