EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H44O9 |
| Net Charge | 0 |
| Average Mass | 656.772 |
| Monoisotopic Mass | 656.29853 |
| SMILES | [H][C@]12C[C@]3([H])C(C)(C)O[C@](C/C=C(\C)C(=O)O)(C1=O)[C@@]31Oc3c(c(O)c4c(c3C(C)(C)C=C)OC(C)(C)c3ccc(C)cc3-4)C(=O)C1C2OC |
| InChI | InChI=1S/C39H44O9/c1-11-35(4,5)27-31-24(20-16-18(2)12-13-22(20)36(6,7)46-31)28(40)25-29(41)26-30(45-10)21-17-23-37(8,9)48-38(33(21)42,15-14-19(3)34(43)44)39(23,26)47-32(25)27/h11-14,16,21,23,26,30,40H,1,15,17H2,2-10H3,(H,43,44)/b19-14+/t21-,23-,26?,30?,38-,39-/m1/s1 |
| InChIKey | CKJQNWPJVMSWAZ-KWMSECQZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Garcinia gaudichaudii (IPNI:427963-1) | bark (BTO:0001301) | PubMed (11101460) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gaudichaudiic acid H (CHEBI:65952) has role antineoplastic agent (CHEBI:35610) |
| gaudichaudiic acid H (CHEBI:65952) has role metabolite (CHEBI:25212) |
| gaudichaudiic acid H (CHEBI:65952) is a bridged compound (CHEBI:35990) |
| gaudichaudiic acid H (CHEBI:65952) is a cyclic ether (CHEBI:37407) |
| gaudichaudiic acid H (CHEBI:65952) is a cyclic ketone (CHEBI:3992) |
| gaudichaudiic acid H (CHEBI:65952) is a organic heteroheptacyclic compound (CHEBI:52157) |
| gaudichaudiic acid H (CHEBI:65952) is a oxo monocarboxylic acid (CHEBI:35871) |
| IUPAC Name |
|---|
| (2E)-4-[(1S,3aR,5R,16aR)-8-hydroxy-6-methoxy-3,3,10,13,13-pentamethyl-15-(2-methylbut-3-en-2-yl)-7,17-dioxo-3a,4,5,6,6a,7-hexahydro-3H,13H-1,5-methanofuro[3,4-g]isochromeno[4,3-b]xanthen-1-yl]-2-methylbut-2-enoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8750131 | Reaxys |
| Citations |
|---|