EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18O6 |
| Net Charge | 0 |
| Average Mass | 342.347 |
| Monoisotopic Mass | 342.11034 |
| SMILES | C=CC(C)(C)c1cc(O)c(OC)c2c(=O)c3c(O)ccc(O)c3oc12 |
| InChI | InChI=1S/C19H18O6/c1-5-19(2,3)9-8-12(22)17(24-4)14-15(23)13-10(20)6-7-11(21)18(13)25-16(9)14/h5-8,20-22H,1H2,2-4H3 |
| InChIKey | QRIMPNRPTNBDIP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Garcinia subelliptica (ncbitaxon:212238) | xylem (BTO:0001468) | Article (CHEM PHARM BULL, 1996, 44, 11, 2103) | Previous component: wood; |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| garciniaxanthone H (CHEBI:65949) has role antioxidant (CHEBI:22586) |
| garciniaxanthone H (CHEBI:65949) has role metabolite (CHEBI:25212) |
| garciniaxanthone H (CHEBI:65949) is a aromatic ether (CHEBI:35618) |
| garciniaxanthone H (CHEBI:65949) is a polyphenol (CHEBI:26195) |
| garciniaxanthone H (CHEBI:65949) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 2,5,8-trihydroxy-1-methoxy-4-(2-methylbut-3-en-2-yl)-9H-xanthen-9-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7661365 | Reaxys |