EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16O5 |
| Net Charge | 0 |
| Average Mass | 336.343 |
| Monoisotopic Mass | 336.09977 |
| SMILES | C=CC(C)(C)c1cc(O)c2oc3c(ccc4ccoc43)c(=O)c2c1O |
| InChI | InChI=1S/C20H16O5/c1-4-20(2,3)12-9-13(21)19-14(16(12)23)15(22)11-6-5-10-7-8-24-17(10)18(11)25-19/h4-9,21,23H,1H2,2-3H3 |
| InChIKey | XYTVIOHQRFERMN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Garcinia subelliptica (ncbitaxon:212238) | xylem (BTO:0001468) | Article (CHEM PHARM BULL, 1996, 44, 11, 2103) | Previous component: wood; |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| garciniaxanthone G (CHEBI:65948) has role antioxidant (CHEBI:22586) |
| garciniaxanthone G (CHEBI:65948) has role metabolite (CHEBI:25212) |
| garciniaxanthone G (CHEBI:65948) is a cyclic ether (CHEBI:37407) |
| garciniaxanthone G (CHEBI:65948) is a cyclic ketone (CHEBI:3992) |
| garciniaxanthone G (CHEBI:65948) is a organic heterotetracyclic compound (CHEBI:38163) |
| garciniaxanthone G (CHEBI:65948) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 7,10-dihydroxy-8-(2-methylbut-3-en-2-yl)-6H-furo[3,2-c]xanthen-6-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7657890 | Reaxys |