EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O3 |
| Net Charge | 0 |
| Average Mass | 454.695 |
| Monoisotopic Mass | 454.34470 |
| SMILES | [H][C@@]12CC(=O)C3=C(CC[C@@]4(C)[C@@]3(C)CC[C@]4([H])[C@H](C)CC/C=C(\C)CO)[C@@]1(C)CCC(=O)C2(C)C |
| InChI | InChI=1S/C30H46O3/c1-19(18-31)9-8-10-20(2)21-11-16-30(7)26-22(12-15-29(21,30)6)28(5)14-13-25(33)27(3,4)24(28)17-23(26)32/h9,20-21,24,31H,8,10-18H2,1-7H3/b19-9+/t20-,21-,24+,28-,29-,30+/m1/s1 |
| InChIKey | SDAWCNCFVWQZDP-GOUGDUPLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma pfeifferi (ncbitaxon:34464) | fruit body (BTO:0000487) | PubMed (16378363) | Mature fruiting bodies |
| Roles Classification |
|---|
| Biological Roles: | anti-HSV-1 agent An anti-HSV agent agent that destroys or inhibits the replication of herpes simplex virus-1. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ganoderone A (CHEBI:65945) has parent hydride lanostane (CHEBI:20265) |
| ganoderone A (CHEBI:65945) has role anti-HSV-1 agent (CHEBI:64953) |
| ganoderone A (CHEBI:65945) has role metabolite (CHEBI:25212) |
| ganoderone A (CHEBI:65945) is a diketone (CHEBI:46640) |
| ganoderone A (CHEBI:65945) is a primary alcohol (CHEBI:15734) |
| ganoderone A (CHEBI:65945) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| (24E)-26-hydroxylanosta-8,24-diene-3,7-dione |
| Synonym | Source |
|---|---|
| 5α-lanosta-8,24-diene-26-hydroxy-3,7-dione | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15775259 | Reaxys |
| Citations |
|---|