EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H22O14 |
| Net Charge | 0 |
| Average Mass | 594.481 |
| Monoisotopic Mass | 594.10096 |
| SMILES | O=C(Oc1cc(O)c2c(c1)OC(c1cc(O)c(OC(=O)c3cc(O)c(O)c(O)c3)c(O)c1)CC2)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C29H22O14/c30-16-9-14(41-28(39)12-5-17(31)25(37)18(32)6-12)10-24-15(16)1-2-23(42-24)11-3-21(35)27(22(36)4-11)43-29(40)13-7-19(33)26(38)20(34)8-13/h3-10,23,30-38H,1-2H2 |
| InChIKey | LRBYDVJXPROTLX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pithecellobium clypearia (ncbitaxon:714486) | leaf (BTO:0000713) | PubMed (16724853) |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7,4'-di-O-galloyltricetiflavan (CHEBI:65944) has functional parent flavan (CHEBI:38691) |
| 7,4'-di-O-galloyltricetiflavan (CHEBI:65944) has role antiviral agent (CHEBI:22587) |
| 7,4'-di-O-galloyltricetiflavan (CHEBI:65944) has role metabolite (CHEBI:25212) |
| 7,4'-di-O-galloyltricetiflavan (CHEBI:65944) is a diester (CHEBI:51307) |
| 7,4'-di-O-galloyltricetiflavan (CHEBI:65944) is a gallate ester (CHEBI:37576) |
| 7,4'-di-O-galloyltricetiflavan (CHEBI:65944) is a trihydroxyflavan (CHEBI:72012) |
| Synonyms | Source |
|---|---|
| 2,6-dihydroxy-4-{5-hydroxy-7-[(3,4,5-trihydroxybenzoyl)oxy]-3,4-dihydro-2H-chromen-2-yl}phenyl 3,4,5-trihydroxybenzoate | ChEBI |
| tricetiflavan-7,4'-di-O-gallate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15869678 | Reaxys |
| Citations |
|---|