EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18O10 |
| Net Charge | 0 |
| Average Mass | 442.376 |
| Monoisotopic Mass | 442.09000 |
| SMILES | O=C(Oc1cc(O)c2c(c1)OC(c1cc(O)c(O)c(O)c1)CC2)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C22H18O10/c23-13-7-11(31-22(30)10-5-16(26)21(29)17(27)6-10)8-19-12(13)1-2-18(32-19)9-3-14(24)20(28)15(25)4-9/h3-8,18,23-29H,1-2H2 |
| InChIKey | XQLJWQWRTLHKGO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pithecellobium clypearia (ncbitaxon:714486) | leaf (BTO:0000713) | PubMed (16724853) |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-O-galloyltricetiflavan (CHEBI:65943) has functional parent flavan (CHEBI:38691) |
| 7-O-galloyltricetiflavan (CHEBI:65943) has role antiviral agent (CHEBI:22587) |
| 7-O-galloyltricetiflavan (CHEBI:65943) has role metabolite (CHEBI:25212) |
| 7-O-galloyltricetiflavan (CHEBI:65943) is a gallate ester (CHEBI:37576) |
| 7-O-galloyltricetiflavan (CHEBI:65943) is a tetrahydroxyflavan (CHEBI:72011) |
| IUPAC Name |
|---|
| 5-hydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-7-yl 3,4,5-trihydroxybenzoate |
| Synonym | Source |
|---|---|
| tricetiflavan-7-O-gallate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15869677 | Reaxys |
| Citations |
|---|