EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16O10 |
| Net Charge | 0 |
| Average Mass | 332.261 |
| Monoisotopic Mass | 332.07435 |
| SMILES | O=C(OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C13H16O10/c14-5-1-4(2-6(15)8(5)16)12(20)22-3-7-9(17)10(18)11(19)13(21)23-7/h1-2,7,9-11,13-19,21H,3H2/t7-,9-,10+,11-,13-/m1/s1 |
| InChIKey | VGVDLJNNDOFWKT-JEUROIALSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sapium sebiferum (ncbitaxon:139772) | leaf (BTO:0000713) | PubMed (7513748) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-O-galloyl-β-D-glucose (CHEBI:65941) has role antihypertensive agent (CHEBI:35674) |
| 6-O-galloyl-β-D-glucose (CHEBI:65941) has role metabolite (CHEBI:25212) |
| 6-O-galloyl-β-D-glucose (CHEBI:65941) is a gallate ester (CHEBI:37576) |
| 6-O-galloyl-β-D-glucose (CHEBI:65941) is a galloyl β-D-glucose (CHEBI:24183) |
| IUPAC Name |
|---|
| 6-O-(3,4,5-trihydroxybenzoyl)-β-D-glucopyranose |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3068868 | Reaxys |
| Citations |
|---|