EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H17NO2 |
| Net Charge | 0 |
| Average Mass | 219.284 |
| Monoisotopic Mass | 219.12593 |
| SMILES | Cc1cccnc1/C=C/C=C/[C@H](O)[C@@H](C)O |
| InChI | InChI=1S/C13H17NO2/c1-10-6-5-9-14-12(10)7-3-4-8-13(16)11(2)15/h3-9,11,13,15-16H,1-2H3/b7-3+,8-4+/t11-,13+/m1/s1 |
| InChIKey | BTUAGFOIXNSRQC-ZCKJOQFBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kitasatospora (ncbitaxon:2063) | - | DOI (10.1016/j.tet.2008.10.040) | Strain: IFM10917 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fuzanin D (CHEBI:65939) has role antineoplastic agent (CHEBI:35610) |
| fuzanin D (CHEBI:65939) has role metabolite (CHEBI:25212) |
| fuzanin D (CHEBI:65939) is a diol (CHEBI:23824) |
| fuzanin D (CHEBI:65939) is a pyridines (CHEBI:26421) |
| fuzanin D (CHEBI:65939) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (2R,3S,4E,6E)-7-(3-methylpyridin-2-yl)hepta-4,6-diene-2,3-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18859417 | Reaxys |
| CAS:1109227-91-9 | Reaxys |