EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24O5 |
| Net Charge | 0 |
| Average Mass | 356.418 |
| Monoisotopic Mass | 356.16237 |
| SMILES | COc1ccc([C@H]2O[C@@H](c3ccc4c(c3)OCO4)[C@H](C)[C@@H]2C)cc1OC |
| InChI | InChI=1S/C21H24O5/c1-12-13(2)21(15-6-8-17-19(10-15)25-11-24-17)26-20(12)14-5-7-16(22-3)18(9-14)23-4/h5-10,12-13,20-21H,11H2,1-4H3/t12-,13+,20-,21+/m0/s1 |
| InChIKey | HSMDOSKNXLVXIP-WVGOSAFVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper futokadsura (IPNI:681476-1) | aerial part (BTO:0001658) | PubMed (15635246) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| futokadsurin C (CHEBI:65938) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| futokadsurin C (CHEBI:65938) has role metabolite (CHEBI:25212) |
| futokadsurin C (CHEBI:65938) is a benzodioxoles (CHEBI:38298) |
| futokadsurin C (CHEBI:65938) is a dimethoxybenzene (CHEBI:51681) |
| futokadsurin C (CHEBI:65938) is a lignan (CHEBI:25036) |
| futokadsurin C (CHEBI:65938) is a oxolanes (CHEBI:26912) |
| IUPAC Name |
|---|
| 5-[(2R,3R,4S,5S)-5-(3,4-dimethoxyphenyl)-3,4-dimethyltetrahydrofuran-2-yl]-1,3-benzodioxole |
| Synonym | Source |
|---|---|
| (7R,8R,7'S,8'S)-3',4'-dimethoxy-3,4-methylenedioxy-7,7'-epoxylignan | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10102564 | Reaxys |
| Citations |
|---|