EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26O5 |
| Net Charge | 0 |
| Average Mass | 358.434 |
| Monoisotopic Mass | 358.17802 |
| SMILES | COc1cc([C@@H]2O[C@H](c3ccc(OC)c(OC)c3)[C@@H](C)[C@@H]2C)ccc1O |
| InChI | InChI=1S/C21H26O5/c1-12-13(2)21(15-7-9-17(23-3)19(11-15)25-5)26-20(12)14-6-8-16(22)18(10-14)24-4/h6-13,20-22H,1-5H3/t12-,13-,20+,21-/m0/s1 |
| InChIKey | YPQNDHHCUQGPFN-IRTBSJMASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper futokadsura (IPNI:681476-1) | aerial part (BTO:0001658) | PubMed (15635246) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| futokadsurin A (CHEBI:65936) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| futokadsurin A (CHEBI:65936) has role metabolite (CHEBI:25212) |
| futokadsurin A (CHEBI:65936) is a lignan (CHEBI:25036) |
| futokadsurin A (CHEBI:65936) is a methoxybenzenes (CHEBI:51683) |
| futokadsurin A (CHEBI:65936) is a oxolanes (CHEBI:26912) |
| futokadsurin A (CHEBI:65936) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 4-[rel-(2R,3S,4S,5S)-5-(3,4-dimethoxyphenyl)-3,4-dimethyltetrahydrofuran-2-yl]-2-methoxyphenol |
| Synonym | Source |
|---|---|
| rel-(7S,8S,7'R,8'S)-3,4,3'-trimethoxy-4'-hydroxy-7,7'-epoxylignan | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10123916 | Reaxys |
| Citations |
|---|