EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H32O3 |
| Net Charge | 0 |
| Average Mass | 356.506 |
| Monoisotopic Mass | 356.23514 |
| SMILES | O=C(O)CCCC#CC#CCCCCCCCCCCCc1ccco1 |
| InChI | InChI=1S/C23H32O3/c24-23(25)20-16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-18-22-19-17-21-26-22/h17,19,21H,1-5,7,9,11,13-16,18,20H2,(H,24,25) |
| InChIKey | AZDANMRNWNLXOP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Polyalthia evecta (IPNI:74568-1) | root (BTO:0001188) | PubMed (16441071) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | anti-HSV-1 agent An anti-HSV agent agent that destroys or inhibits the replication of herpes simplex virus-1. antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 19-(2-furyl)nonadeca-5,7-diynoic acid (CHEBI:65935) has role anti-HSV-1 agent (CHEBI:64953) |
| 19-(2-furyl)nonadeca-5,7-diynoic acid (CHEBI:65935) has role antiplasmodial drug (CHEBI:64915) |
| 19-(2-furyl)nonadeca-5,7-diynoic acid (CHEBI:65935) has role metabolite (CHEBI:25212) |
| 19-(2-furyl)nonadeca-5,7-diynoic acid (CHEBI:65935) is a acetylenic fatty acid (CHEBI:25380) |
| 19-(2-furyl)nonadeca-5,7-diynoic acid (CHEBI:65935) is a furans (CHEBI:24129) |
| IUPAC Name |
|---|
| 19-(furan-2-yl)nonadeca-5,7-diynoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9668964 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18586861 | Reaxys |
| Citations |
|---|