EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H32O3 |
| Net Charge | 0 |
| Average Mass | 356.506 |
| Monoisotopic Mass | 356.23514 |
| SMILES | O=C(O)CCCC#CC#CCCCCCCCCCCCc1ccco1 |
| InChI | InChI=1S/C23H32O3/c24-23(25)20-16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-18-22-19-17-21-26-22/h17,19,21H,1-5,7,9,11,13-16,18,20H2,(H,24,25) |
| InChIKey | AZDANMRNWNLXOP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Polyalthia evecta (IPNI:74568-1) | root (BTO:0001188) | PubMed (16441071) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HSV-1 agent An anti-HSV agent agent that destroys or inhibits the replication of herpes simplex virus-1. antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. |
| Application: | antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 19-(2-furyl)nonadeca-5,7-diynoic acid (CHEBI:65935) has role anti-HSV-1 agent (CHEBI:64953) |
| 19-(2-furyl)nonadeca-5,7-diynoic acid (CHEBI:65935) has role antiplasmodial drug (CHEBI:64915) |
| 19-(2-furyl)nonadeca-5,7-diynoic acid (CHEBI:65935) has role metabolite (CHEBI:25212) |
| 19-(2-furyl)nonadeca-5,7-diynoic acid (CHEBI:65935) is a acetylenic fatty acid (CHEBI:25380) |
| 19-(2-furyl)nonadeca-5,7-diynoic acid (CHEBI:65935) is a furans (CHEBI:24129) |
| IUPAC Name |
|---|
| 19-(furan-2-yl)nonadeca-5,7-diynoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9668964 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18586861 | Reaxys |
| Citations |
|---|