EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H26O7 |
| Net Charge | 0 |
| Average Mass | 438.476 |
| Monoisotopic Mass | 438.16785 |
| SMILES | CC(C)=CCc1c2c(c3occ(-c4ccc(O)c(O)c4)c(=O)c3c1O)CC(C(C)(C)O)O2 |
| InChI | InChI=1S/C25H26O7/c1-12(2)5-7-14-21(28)20-22(29)16(13-6-8-17(26)18(27)9-13)11-31-24(20)15-10-19(25(3,4)30)32-23(14)15/h5-6,8-9,11,19,26-28,30H,7,10H2,1-4H3 |
| InChIKey | YOKJEIDBLPWOSL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Millettia pachycarpa (ncbitaxon:690557) | leaf (BTO:0000713) | PubMed (16441086) | 11:10 enantiomeric mixture |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-estrogen A drug which acts to reduce estrogenic activity in the body, either by reducing the amount of estrogen or by reducing the activity of whatever estrogen is present. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| furowanin B (CHEBI:65934) has role anti-estrogen (CHEBI:50751) |
| furowanin B (CHEBI:65934) has role metabolite (CHEBI:25212) |
| furowanin B (CHEBI:65934) is a hydroxyisoflavone (CHEBI:38755) |
| furowanin B (CHEBI:65934) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| 3-(3,4-dihydroxyphenyl)-5-hydroxy-8-(2-hydroxypropan-2-yl)-6-(3-methylbut-2-en-1-yl)-8,9-dihydro-4H-furo[2,3-h]chromen-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18586899 | Reaxys |
| Citations |
|---|