EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15NO7 |
| Net Charge | 0 |
| Average Mass | 333.296 |
| Monoisotopic Mass | 333.08485 |
| SMILES | C/C=C/c1c(O)c(O)cc2c1[C@@](C)(NC(=O)/C=C/C(=O)O)C(=O)O2 |
| InChI | InChI=1S/C16H15NO7/c1-3-4-8-13-10(7-9(18)14(8)22)24-15(23)16(13,2)17-11(19)5-6-12(20)21/h3-7,18,22H,1-2H3,(H,17,19)(H,20,21)/b4-3+,6-5+/t16-/m1/s1 |
| InChIKey | QWMZGLCXYLPQAZ-CJWQODIFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus fumisynnematus (ncbitaxon:286432) | - | PubMed (17523650) | Strain: F746 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. EC 3.5.1.88 (peptide deformylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the action of peptide deformylase (EC 3.5.1.88), involved in the catalytic removal of the N-terminal formyl group of nascent proteins. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fumimycin (CHEBI:65931) has role Aspergillus metabolite (CHEBI:76956) |
| fumimycin (CHEBI:65931) has role antibacterial agent (CHEBI:33282) |
| fumimycin (CHEBI:65931) has role EC 3.5.1.88 (peptide deformylase) inhibitor (CHEBI:71951) |
| fumimycin (CHEBI:65931) is a 1-benzofurans (CHEBI:38830) |
| fumimycin (CHEBI:65931) is a dicarboxylic acid monoamide (CHEBI:35735) |
| fumimycin (CHEBI:65931) is a monocarboxylic acid (CHEBI:25384) |
| fumimycin (CHEBI:65931) is a polyphenol (CHEBI:26195) |
| fumimycin (CHEBI:65931) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (2E)-4-({(3R)-5,6-dihydroxy-3-methyl-2-oxo-4-[(1E)-prop-1-en-1-yl]-2,3-dihydro-1-benzofuran-3-yl}amino)-4-oxobut-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 20557857 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21037523 | Reaxys |
| Citations |
|---|