EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28O5 |
| Net Charge | 0 |
| Average Mass | 408.494 |
| Monoisotopic Mass | 408.19367 |
| SMILES | COc1ccc2c3c(c(=O)oc2c1)[C@@](C)(CC/C=C(\C)Cc1cc(C)co1)[C@H](C)O3 |
| InChI | InChI=1S/C25H28O5/c1-15(11-19-12-16(2)14-28-19)7-6-10-25(4)17(3)29-23-20-9-8-18(27-5)13-21(20)30-24(26)22(23)25/h7-9,12-14,17H,6,10-11H2,1-5H3/b15-7+/t17-,25-/m0/s1 |
| InChIKey | VQRPFWMTIIMDKU-KFRXIPAMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ferula fukanensis (IPNI:842281-1) | root (BTO:0001188) | PubMed (15467238) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fukanefuromarin E (CHEBI:65925) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| fukanefuromarin E (CHEBI:65925) has role metabolite (CHEBI:25212) |
| fukanefuromarin E (CHEBI:65925) is a aromatic ether (CHEBI:35618) |
| fukanefuromarin E (CHEBI:65925) is a furanocoumarin (CHEBI:24128) |
| fukanefuromarin E (CHEBI:65925) is a furans (CHEBI:24129) |
| fukanefuromarin E (CHEBI:65925) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| (2S*,3R*)-7-methoxy-2,3-dimethyl-3-[(3E)-4-methyl-5-(4-methylfuran-2-yl)pent-3-en-1-yl]-2,3-dihydro-4H-furo[3,2-c]chromen-4-one |
| Synonym | Source |
|---|---|
| 2,3-dihydro-7-methoxy-2S*,3R*-dimethyl-3-[4-methyl-5-(4-methyl-2-furyl)-3(E)-pentenyl]-furo[3,2-c]coumarin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9972943 | Reaxys |
| Citations |
|---|