EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28O5 |
| Net Charge | 0 |
| Average Mass | 396.483 |
| Monoisotopic Mass | 396.19367 |
| SMILES | CC(C)=CC(=O)/C=C(/C)CCC[C@@]1(C)Oc2c(c(=O)oc3cc(O)ccc23)[C@@H]1C |
| InChI | InChI=1S/C24H28O5/c1-14(2)11-18(26)12-15(3)7-6-10-24(5)16(4)21-22(29-24)19-9-8-17(25)13-20(19)28-23(21)27/h8-9,11-13,16,25H,6-7,10H2,1-5H3/b15-12-/t16-,24+/m0/s1 |
| InChIKey | NWTCYOAKBSTWBB-NWMOAKGTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ferula fukanensis (IPNI:842281-1) | root (BTO:0001188) | PubMed (15043424) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fukanefuromarin C (CHEBI:65923) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| fukanefuromarin C (CHEBI:65923) has role metabolite (CHEBI:25212) |
| fukanefuromarin C (CHEBI:65923) is a furanocoumarin (CHEBI:24128) |
| fukanefuromarin C (CHEBI:65923) is a ketone (CHEBI:17087) |
| fukanefuromarin C (CHEBI:65923) is a phenols (CHEBI:33853) |
| fukanefuromarin C (CHEBI:65923) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| (2R*,3S*)-2-[(4Z)-4,8-dimethyl-6-oxonona-4,7-dien-1-yl]-7-hydroxy-2,3-dimethyl-2,3-dihydro-4H-furo[3,2-c]chromen-4-one |
| Synonym | Source |
|---|---|
| 2,3-dihydro-7-hydroxy-2S*,3R*-dimethyl-2-[4,8-dimethyl-4(Z),7-nonadien-6-only]furo[3,2-c]coumarin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10216261 | Reaxys |
| Citations |
|---|