EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H18O12 |
| Net Charge | 0 |
| Average Mass | 498.396 |
| Monoisotopic Mass | 498.07983 |
| SMILES | Oc1cc(O)c(Oc2cc(O)cc(O)c2Oc2cc(O)cc(O)c2-c2c(O)cc(O)cc2O)c(O)c1 |
| InChI | InChI=1S/C24H18O12/c25-9-1-13(29)21(14(30)2-9)22-15(31)3-11(27)7-19(22)35-24-18(34)6-12(28)8-20(24)36-23-16(32)4-10(26)5-17(23)33/h1-8,25-34H |
| InChIKey | DUSGAYNDQIKXHD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ecklonia cava (ncbitaxon:105407) | - | PubMed (19201199) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| Applications: | anti-allergic agent A drug used to treat allergic reactions. hypoglycemic agent A drug which lowers the blood glucose level. astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fucodiphloroethol G (CHEBI:65918) has functional parent phloroglucinol (CHEBI:16204) |
| fucodiphloroethol G (CHEBI:65918) has role anti-allergic agent (CHEBI:50857) |
| fucodiphloroethol G (CHEBI:65918) has role antioxidant (CHEBI:22586) |
| fucodiphloroethol G (CHEBI:65918) has role hypoglycemic agent (CHEBI:35526) |
| fucodiphloroethol G (CHEBI:65918) has role metabolite (CHEBI:25212) |
| fucodiphloroethol G (CHEBI:65918) is a aromatic ether (CHEBI:35618) |
| fucodiphloroethol G (CHEBI:65918) is a phlorotannin (CHEBI:71222) |
| IUPAC Name |
|---|
| 6'-[2,4-dihydroxy-6-(2,4,6-trihydroxyphenoxy)phenoxy]biphenyl-2,2',4,4',6-pentol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20009564 | Reaxys |
| Citations |
|---|