EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42ClNO8 |
| Net Charge | 0 |
| Average Mass | 544.085 |
| Monoisotopic Mass | 543.25989 |
| SMILES | CC(=O)OC(C)/C=C\C(=O)NC1CC(C)C(C/C=C(C)/C=C/C2O[C@](C)(O)C[C@@](O)(CCl)[C@@H]2O)OC1C |
| InChI | InChI=1S/C27H42ClNO8/c1-16(8-11-23-25(32)27(34,15-28)14-26(6,33)37-23)7-10-22-17(2)13-21(19(4)36-22)29-24(31)12-9-18(3)35-20(5)30/h7-9,11-12,17-19,21-23,25,32-34H,10,13-15H2,1-6H3,(H,29,31)/b11-8+,12-9-,16-7+/t17?,18?,19?,21?,22?,23?,25-,26+,27-/m1/s1 |
| InChIKey | RONUKPQOBQKEHX-FOUIGEGESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas sp. 2663 (ncbitaxon:764483) | - | PubMed (9031664) | Strain: 2663 |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FR901463 (CHEBI:65914) has role antimicrobial agent (CHEBI:33281) |
| FR901463 (CHEBI:65914) has role antineoplastic agent (CHEBI:35610) |
| FR901463 (CHEBI:65914) has role bacterial metabolite (CHEBI:76969) |
| FR901463 (CHEBI:65914) is a acetate ester (CHEBI:47622) |
| FR901463 (CHEBI:65914) is a cyclic hemiketal (CHEBI:59780) |
| FR901463 (CHEBI:65914) is a monocarboxylic acid amide (CHEBI:29347) |
| FR901463 (CHEBI:65914) is a organochlorine compound (CHEBI:36683) |
| FR901463 (CHEBI:65914) is a pyrans (CHEBI:26407) |
| IUPAC Name |
|---|
| 6-[(1E,3E)-5-(5-{[(2Z)-4-(acetyloxy)pent-2-enoyl]amino}-3,6-dimethyltetrahydro-2H-pyran-2-yl)-3-methylpenta-1,3-dien-1-yl]-4-C-(chloromethyl)-1,3-dideoxy-α-D-erythro-hex-2-ulopyranose |
| Synonym | Source |
|---|---|
| (3Z)-5-[(6-{(2E,4E)-5-[(3R,4S,6S)-4-(chloromethyl)-3,4,6-trihydroxy-6-methyltetrahydro-2H-pyran-2-yl]-3-methylpenta-2,4-dien-1-yl}-2,5-dimethyltetrahydro-2H-pyran-3-yl)amino]-5-oxopent-3-en-2-yl acetate | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8176949 | Reaxys |
| CAS:146478-74-2 | ChemIDplus |
| Citations |
|---|