EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H62O10 |
| Net Charge | 0 |
| Average Mass | 678.904 |
| Monoisotopic Mass | 678.43430 |
| SMILES | [H][C@@]1(O[C@H]2[C@H](OC(C)=O)C[C@]3(C)C4=C(CC[C@@]3([H])C2(C)C)[C@@]2(C)CC[C@](C)([C@H](C)C(C)C)[C@@H](C(=O)O)[C@]2(C)CC4)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C38H62O10/c1-19(2)20(3)35(7)15-16-37(9)23-11-12-26-34(5,6)31(48-33-29(43)28(42)27(41)25(18-39)47-33)24(46-21(4)40)17-36(26,8)22(23)13-14-38(37,10)30(35)32(44)45/h19-20,24-31,33,39,41-43H,11-18H2,1-10H3,(H,44,45)/t20-,24-,25-,26+,27-,28+,29-,30-,31+,33+,35-,36-,37-,38+/m1/s1 |
| InChIKey | VAULMUOCCMYLIA-SQBLQFOUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium (ncbitaxon:5149) | - | PubMed (15784979) | Strain: 217 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FR207944 (CHEBI:65913) has functional parent β-D-glucose (CHEBI:15903) |
| FR207944 (CHEBI:65913) has role Chaetomium metabolite (CHEBI:76960) |
| FR207944 (CHEBI:65913) has role antifungal agent (CHEBI:35718) |
| FR207944 (CHEBI:65913) has role antimicrobial agent (CHEBI:33281) |
| FR207944 (CHEBI:65913) is a acetate ester (CHEBI:47622) |
| FR207944 (CHEBI:65913) is a monocarboxylic acid (CHEBI:25384) |
| FR207944 (CHEBI:65913) is a monosaccharide derivative (CHEBI:63367) |
| FR207944 (CHEBI:65913) is a triterpenoid saponin (CHEBI:61778) |
| IUPAC Name |
|---|
| (1R,2R,4aS,6aR,8R,9R,10aS,12aS)-9-(acetyloxy)-8-(β-D-glucopyranosyloxy)-2,4a,7,7,10a,12a-hexamethyl-2-[(2R)-3-methylbutan-2-yl]-1,2,3,4,4a,5,6,6a,7,8,9,10,10a,11,12,12a-hexadecahydrochrysene-1-carboxylic acid |
| Citations |
|---|