EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H62O10 |
| Net Charge | 0 |
| Average Mass | 678.904 |
| Monoisotopic Mass | 678.43430 |
| SMILES | [H][C@@]1(O[C@H]2[C@H](OC(C)=O)C[C@]3(C)C4=C(CC[C@@]3([H])C2(C)C)[C@@]2(C)CC[C@](C)([C@H](C)C(C)C)[C@@H](C(=O)O)[C@]2(C)CC4)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C38H62O10/c1-19(2)20(3)35(7)15-16-37(9)23-11-12-26-34(5,6)31(48-33-29(43)28(42)27(41)25(18-39)47-33)24(46-21(4)40)17-36(26,8)22(23)13-14-38(37,10)30(35)32(44)45/h19-20,24-31,33,39,41-43H,11-18H2,1-10H3,(H,44,45)/t20-,24-,25-,26+,27-,28+,29-,30-,31+,33+,35-,36-,37-,38+/m1/s1 |
| InChIKey | VAULMUOCCMYLIA-SQBLQFOUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium (ncbitaxon:5149) | - | PubMed (15784979) | Strain: 217 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FR207944 (CHEBI:65913) has functional parent β-D-glucose (CHEBI:15903) |
| FR207944 (CHEBI:65913) has role Chaetomium metabolite (CHEBI:76960) |
| FR207944 (CHEBI:65913) has role antifungal agent (CHEBI:35718) |
| FR207944 (CHEBI:65913) has role antimicrobial agent (CHEBI:33281) |
| FR207944 (CHEBI:65913) is a acetate ester (CHEBI:47622) |
| FR207944 (CHEBI:65913) is a monocarboxylic acid (CHEBI:25384) |
| FR207944 (CHEBI:65913) is a monosaccharide derivative (CHEBI:63367) |
| FR207944 (CHEBI:65913) is a triterpenoid saponin (CHEBI:61778) |
| IUPAC Name |
|---|
| (1R,2R,4aS,6aR,8R,9R,10aS,12aS)-9-(acetyloxy)-8-(β-D-glucopyranosyloxy)-2,4a,7,7,10a,12a-hexamethyl-2-[(2R)-3-methylbutan-2-yl]-1,2,3,4,4a,5,6,6a,7,8,9,10,10a,11,12,12a-hexadecahydrochrysene-1-carboxylic acid |
| Citations |
|---|