EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H31ClO8 |
| Net Charge | 0 |
| Average Mass | 470.946 |
| Monoisotopic Mass | 470.17075 |
| SMILES | [H][C@]1([C@H](O)/C=C(\C)CC(=O)O)O[C@@H]2CC/C(Cl)=C/C/C=C(/C)[C@H](OC(C)=O)CC(=O)O[C@@H]1C2 |
| InChI | InChI=1S/C23H31ClO8/c1-13(10-21(27)28)9-18(26)23-20-11-17(31-23)8-7-16(24)6-4-5-14(2)19(30-15(3)25)12-22(29)32-20/h5-6,9,17-20,23,26H,4,7-8,10-12H2,1-3H3,(H,27,28)/b13-9+,14-5-,16-6-/t17-,18-,19-,20-,23-/m1/s1 |
| InChIKey | OAWOFENLLWPBEQ-VXLXENEISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Serratia liquefaciens (ncbitaxon:614) | - | PubMed (16392679) | Strain: 1821 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FR177391 (CHEBI:65911) has role antilipemic drug (CHEBI:35679) |
| FR177391 (CHEBI:65911) has role metabolite (CHEBI:25212) |
| FR177391 (CHEBI:65911) is a acetate ester (CHEBI:47622) |
| FR177391 (CHEBI:65911) is a bridged compound (CHEBI:35990) |
| FR177391 (CHEBI:65911) is a cyclic ether (CHEBI:37407) |
| FR177391 (CHEBI:65911) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| FR177391 (CHEBI:65911) is a macrolide (CHEBI:25106) |
| FR177391 (CHEBI:65911) is a organic heterobicyclic compound (CHEBI:27171) |
| FR177391 (CHEBI:65911) is a organochlorine compound (CHEBI:36683) |
| FR177391 (CHEBI:65911) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (3E,5R)-5-[(1R,5R,6Z,9Z,13R,15R)-5-(acetyloxy)-10-chloro-6-methyl-3-oxo-2,14-dioxabicyclo[11.2.1]hexadeca-6,9-dien-15-yl]-5-hydroxy-3-methylpent-3-enoic acid |
| Citations |
|---|