EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12N2O2 |
| Net Charge | 0 |
| Average Mass | 240.262 |
| Monoisotopic Mass | 240.08988 |
| SMILES | COc1cccc2nnc3cccc(OC)c3c12 |
| InChI | InChI=1S/C14H12N2O2/c1-17-11-7-3-5-9-13(11)14-10(16-15-9)6-4-8-12(14)18-2/h3-8H,1-2H3 |
| InChIKey | DKHBOZGVMLZLLL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (17551212) | Strain: 4849 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4849F (CHEBI:65910) has role antimicrobial agent (CHEBI:33281) |
| 4849F (CHEBI:65910) has role metabolite (CHEBI:25212) |
| 4849F (CHEBI:65910) is a aromatic ether (CHEBI:35618) |
| 4849F (CHEBI:65910) is a azaarene (CHEBI:50893) |
| 4849F (CHEBI:65910) is a organic heterotricyclic compound (CHEBI:26979) |
| IUPAC Name |
|---|
| 1,10-dimethoxybenzo[c]cinnoline |
| Citations |
|---|