EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22N2 |
| Net Charge | 0 |
| Average Mass | 242.366 |
| Monoisotopic Mass | 242.17830 |
| SMILES | [H][C@]12CCCN[C@]13C[C@H](C)C[C@H]2Cc1ncccc13 |
| InChI | InChI=1S/C16H22N2/c1-11-8-12-9-15-14(5-2-6-17-15)16(10-11)13(12)4-3-7-18-16/h2,5-6,11-13,18H,3-4,7-10H2,1H3/t11-,12+,13-,16-/m1/s1 |
| InChIKey | JJPMUZRSJKMFRK-OQMKEHIESA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lycodine (CHEBI:6591) is a phenanthrol (CHEBI:25962) |
| Synonym | Source |
|---|---|
| Lycodine | KEGG COMPOUND |