EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H57N5O10 |
| Net Charge | 0 |
| Average Mass | 743.899 |
| Monoisotopic Mass | 743.41054 |
| SMILES | CCCCCCCCCC(OC(=O)[C@H](CCCCN(O)C=O)NC(=O)c1nc(-c2ccccc2O)oc1C)C(C)(C)C(=O)NC1CCCCN(O)C1=O |
| InChI | InChI=1S/C38H57N5O10/c1-5-6-7-8-9-10-11-22-31(38(3,4)37(49)40-28-19-15-17-24-43(51)35(28)47)53-36(48)29(20-14-16-23-42(50)25-44)39-33(46)32-26(2)52-34(41-32)27-18-12-13-21-30(27)45/h12-13,18,21,25,28-29,31,45,50-51H,5-11,14-17,19-20,22-24H2,1-4H3,(H,39,46)(H,40,49)/t28?,29-,31?/m0/s1 |
| InChIKey | ZZBSPTCNZDTZBR-QGXZNONUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nocardia (ncbitaxon:1821) | - | PubMed (8931715) | Strain: ND20 |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| formobactin (CHEBI:65906) has role antimicrobial agent (CHEBI:33281) |
| formobactin (CHEBI:65906) has role bacterial metabolite (CHEBI:76969) |
| formobactin (CHEBI:65906) has role radical scavenger (CHEBI:48578) |
| formobactin (CHEBI:65906) is a 1,3-oxazoles (CHEBI:46812) |
| formobactin (CHEBI:65906) is a carboxylic ester (CHEBI:33308) |
| formobactin (CHEBI:65906) is a cyclic hydroxamic acid (CHEBI:23445) |
| formobactin (CHEBI:65906) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 1-[(1-hydroxy-2-oxoazepan-3-yl)amino]-2,2-dimethyl-1-oxododecan-3-yl N6-formyl-N6-hydroxy-N2-{[2-(2-hydroxyphenyl)-5-methyl-1,3-oxazol-4-yl]carbonyl}-L-lysinate |
| Citations |
|---|