EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16O4 |
| Net Charge | 0 |
| Average Mass | 284.311 |
| Monoisotopic Mass | 284.10486 |
| SMILES | COc1cc(O)c(C(=O)/C=C/c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C17H16O4/c1-20-13-10-15(19)17(16(11-13)21-2)14(18)9-8-12-6-4-3-5-7-12/h3-11,19H,1-2H3/b9-8+ |
| InChIKey | QKQLSQLKXBHUSO-CMDGGOBGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper methysticum (ncbitaxon:130404) | - | PubMed (11830162) | |
| Piper rusbyi (ncbitaxon:538341) | leaf (BTO:0000713) | PubMed (17354169) |
| Roles Classification |
|---|
| Biological Roles: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flavokawain B (CHEBI:65899) has functional parent trans-chalcone (CHEBI:48965) |
| flavokawain B (CHEBI:65899) has role anti-inflammatory agent (CHEBI:67079) |
| flavokawain B (CHEBI:65899) has role antileishmanial agent (CHEBI:70868) |
| flavokawain B (CHEBI:65899) has role antineoplastic agent (CHEBI:35610) |
| flavokawain B (CHEBI:65899) has role apoptosis inducer (CHEBI:68495) |
| flavokawain B (CHEBI:65899) has role metabolite (CHEBI:25212) |
| flavokawain B (CHEBI:65899) is a chalcones (CHEBI:23086) |
| flavokawain B (CHEBI:65899) is a dimethoxybenzene (CHEBI:51681) |
| flavokawain B (CHEBI:65899) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (2E)-1-(2-hydroxy-4,6-dimethoxyphenyl)-3-phenylprop-2-en-1-one |
| Synonyms | Source |
|---|---|
| 2'-hydroxy-4',6'-dimethoxychalcone | HMDB |
| 4',6'-dimethoxy-2'-hydroxychalcone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0033691 | HMDB |
| WO2005067950 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2059845 | Reaxys |
| CAS:1175-97-9 | ChemIDplus |
| Citations |
|---|