EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28O8 |
| Net Charge | 0 |
| Average Mass | 432.469 |
| Monoisotopic Mass | 432.17842 |
| SMILES | CCCC(=O)c1c(O)c(C)c(O)c(CC2=C(O)C(C)(C)C(O)=C(C(=O)CC)C2=O)c1O |
| InChI | InChI=1S/C23H28O8/c1-6-8-14(25)15-18(27)10(3)17(26)11(19(15)28)9-12-20(29)16(13(24)7-2)22(31)23(4,5)21(12)30/h26-28,30-31H,6-9H2,1-5H3 |
| InChIKey | NGODKUCEKYYIFN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dryopteris crassirhizoma (ncbitaxon:97234) | rhizome (BTO:0001181) | PubMed (12951487) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flavaspidic acid PB (CHEBI:65898) has functional parent phloroglucinol (CHEBI:16204) |
| flavaspidic acid PB (CHEBI:65898) has role antibacterial agent (CHEBI:33282) |
| flavaspidic acid PB (CHEBI:65898) has role metabolite (CHEBI:25212) |
| flavaspidic acid PB (CHEBI:65898) has role radical scavenger (CHEBI:48578) |
| flavaspidic acid PB (CHEBI:65898) is a aromatic ketone (CHEBI:76224) |
| flavaspidic acid PB (CHEBI:65898) is a polyphenol (CHEBI:26195) |
| flavaspidic acid PB (CHEBI:65898) is a β-hydroxy ketone (CHEBI:55380) |
| IUPAC Name |
|---|
| 2-(3-butyryl-2,4,6-trihydroxy-5-methylbenzyl)-3,5-dihydroxy-4,4-dimethyl-6-propionylcyclohexa-2,5-dien-1-one |
| Manual Xrefs | Databases |
|---|---|
| 23275363 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2684769 | Reaxys |
| Citations |
|---|