EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26O8 |
| Net Charge | 0 |
| Average Mass | 418.442 |
| Monoisotopic Mass | 418.16277 |
| SMILES | CCCC(=O)c1c(O)c(C)c(O)c(CC2=C(O)C(C)(C)C(O)=C(C(C)=O)C2=O)c1O |
| InChI | InChI=1S/C22H26O8/c1-6-7-13(24)15-17(26)9(2)16(25)11(18(15)27)8-12-19(28)14(10(3)23)21(30)22(4,5)20(12)29/h25-27,29-30H,6-8H2,1-5H3 |
| InChIKey | XRWVZSPWRNDJNS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dryopteris crassirhizoma (ncbitaxon:97234) | rhizome (BTO:0001181) | PubMed (12951487) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flavaspidic acid AB (CHEBI:65897) has functional parent phloroglucinol (CHEBI:16204) |
| flavaspidic acid AB (CHEBI:65897) has role antibacterial agent (CHEBI:33282) |
| flavaspidic acid AB (CHEBI:65897) has role metabolite (CHEBI:25212) |
| flavaspidic acid AB (CHEBI:65897) is a aromatic ketone (CHEBI:76224) |
| flavaspidic acid AB (CHEBI:65897) is a methyl ketone (CHEBI:51867) |
| flavaspidic acid AB (CHEBI:65897) is a polyphenol (CHEBI:26195) |
| flavaspidic acid AB (CHEBI:65897) is a β-hydroxy ketone (CHEBI:55380) |
| Manual Xrefs | Databases |
|---|---|
| 23275362 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2067974 | Reaxys |
| Citations |
|---|