EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26O8 |
| Net Charge | 0 |
| Average Mass | 418.442 |
| Monoisotopic Mass | 418.16277 |
| SMILES | CCCC(=O)c1c(O)c(C)c(O)c(CC2=C(O)C(C)(C)C(O)=C(C(C)=O)C2=O)c1O |
| InChI | InChI=1S/C22H26O8/c1-6-7-13(24)15-17(26)9(2)16(25)11(18(15)27)8-12-19(28)14(10(3)23)21(30)22(4,5)20(12)29/h25-27,29-30H,6-8H2,1-5H3 |
| InChIKey | XRWVZSPWRNDJNS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dryopteris crassirhizoma (ncbitaxon:97234) | rhizome (BTO:0001181) | PubMed (12951487) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flavaspidic acid AB (CHEBI:65897) has functional parent phloroglucinol (CHEBI:16204) |
| flavaspidic acid AB (CHEBI:65897) has role antibacterial agent (CHEBI:33282) |
| flavaspidic acid AB (CHEBI:65897) has role metabolite (CHEBI:25212) |
| flavaspidic acid AB (CHEBI:65897) is a aromatic ketone (CHEBI:76224) |
| flavaspidic acid AB (CHEBI:65897) is a methyl ketone (CHEBI:51867) |
| flavaspidic acid AB (CHEBI:65897) is a polyphenol (CHEBI:26195) |
| flavaspidic acid AB (CHEBI:65897) is a β-hydroxy ketone (CHEBI:55380) |
| Manual Xrefs | Databases |
|---|---|
| 23275362 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2067974 | Reaxys |
| Citations |
|---|