EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16O4 |
| Net Charge | 0 |
| Average Mass | 236.267 |
| Monoisotopic Mass | 236.10486 |
| SMILES | C/C=C/C1OC(/C=C/C)C2OC(=O)C(O)C=C12 |
| InChI | InChI=1S/C13H16O4/c1-3-5-10-8-7-9(14)13(15)17-12(8)11(16-10)6-4-2/h3-7,9-12,14H,1-2H3/b5-3+,6-4+ |
| InChIKey | DXYMGZNZFBKDCX-GGWOSOGESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Myceliophthora lutea (fungorum:232833) | - | PubMed (7706120) | Strain: TF 0409 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FD-211 (CHEBI:65896) has role antineoplastic agent (CHEBI:35610) |
| FD-211 (CHEBI:65896) has role metabolite (CHEBI:25212) |
| FD-211 (CHEBI:65896) is a organic heterobicyclic compound (CHEBI:27171) |
| FD-211 (CHEBI:65896) is a secondary alcohol (CHEBI:35681) |
| FD-211 (CHEBI:65896) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| 3-hydroxy-5,7-di[(1E)-prop-1-en-1-yl]-3,5,7,7a-tetrahydro-2H-furo[3,4-b]pyran-2-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7297870 | Reaxys |
| Citations |
|---|