EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C81H150O28 |
| Net Charge | 0 |
| Average Mass | 1572.063 |
| Monoisotopic Mass | 1571.03136 |
| SMILES | CC(O)CCCCCCCCCCCCCCC(CCCCCCCCCCCCCC1CC(=O)OC[C@H]2O[C@@H](OC(CCCCCCCCCCCCCC(CCCCCC(C)O)O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)CC(=O)OC[C@H]3O[C@@H](O1)[C@H](O)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C81H150O28/c1-54(84)40-32-25-19-13-7-3-4-8-14-20-26-34-42-56(102-78-74(96)70(92)66(88)60(50-82)106-78)43-35-27-21-15-9-5-11-17-23-29-37-46-58-48-64(86)100-52-63-69(91)73(95)77(99)81(109-63)105-59(49-65(87)101-53-62-68(90)72(94)76(98)80(104-58)108-62)47-38-30-24-18-12-6-10-16-22-28-36-44-57(45-39-31-33-41-55(2)85)103-79-75(97)71(93)67(89)61(51-83)107-79/h54-63,66-85,88-99H,3-53H2,1-2H3/t54?,55?,56?,57?,58?,59?,60-,61-,62-,63-,66-,67-,68-,69-,70+,71+,72+,73+,74-,75-,76-,77-,78-,79-,80-,81-/m1/s1 |
| InChIKey | YQYKMOMCJFNBBQ-MJSFJGRCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces microflavus (ncbitaxon:1919) | - | PubMed (9918397) | Strain: 2445 |
| Roles Classification |
|---|
| Biological Roles: | anti-HSV-1 agent An anti-HSV agent agent that destroys or inhibits the replication of herpes simplex virus-1. EC 3.2.1.18 (exo-alpha-sialidase) inhibitor An antiviral drug targeted at influenza viruses. Its mode of action consists of blocking the function of the viral neuraminidase protein (EC 3.2.1.18), thus preventing the virus from budding from the host cell. anti-HIV-1 agent An anti-HIV agent that destroys or inhibits the replication of HIV-1, the more infective and more virulent of the two types of HIV virus. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | EC 3.2.1.18 (exo-alpha-sialidase) inhibitor An antiviral drug targeted at influenza viruses. Its mode of action consists of blocking the function of the viral neuraminidase protein (EC 3.2.1.18), thus preventing the virus from budding from the host cell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fattiviracin A1 (CHEBI:65895) has role anti-HIV-1 agent (CHEBI:64947) |
| fattiviracin A1 (CHEBI:65895) has role anti-HSV-1 agent (CHEBI:64953) |
| fattiviracin A1 (CHEBI:65895) has role EC 3.2.1.18 (exo-α-sialidase) inhibitor (CHEBI:52425) |
| fattiviracin A1 (CHEBI:65895) has role metabolite (CHEBI:25212) |
| fattiviracin A1 (CHEBI:65895) is a carbohydrate-containing antibiotic (CHEBI:23007) |
| fattiviracin A1 (CHEBI:65895) is a fatty acid derivative (CHEBI:61697) |
| fattiviracin A1 (CHEBI:65895) is a macrodiolide (CHEBI:145556) |
| fattiviracin A1 (CHEBI:65895) is a β-D-glucoside (CHEBI:22798) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8186205 | Reaxys |
| CAS:214417-77-3 | ChemIDplus |
| Citations |
|---|