EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O7 |
| Net Charge | 0 |
| Average Mass | 318.281 |
| Monoisotopic Mass | 318.07395 |
| SMILES | COC(=O)[C@]12Oc3cc(CO)cc(O)c3C(=O)C1=CC=C[C@H]2O |
| InChI | InChI=1S/C16H14O7/c1-22-15(21)16-9(3-2-4-12(16)19)14(20)13-10(18)5-8(7-17)6-11(13)23-16/h2-6,12,17-19H,7H2,1H3/t12-,16+/m1/s1 |
| InChIKey | PMHCAQUSIVAZPO-WBMJQRKESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (9711252) | Strain: AJ117291 |
| Roles Classification |
|---|
| Biological Roles: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| F390C (CHEBI:65894) has role Penicillium metabolite (CHEBI:76964) |
| F390C (CHEBI:65894) has role antimicrobial agent (CHEBI:33281) |
| F390C (CHEBI:65894) has role antineoplastic agent (CHEBI:35610) |
| F390C (CHEBI:65894) is a benzyl alcohols (CHEBI:22743) |
| F390C (CHEBI:65894) is a methyl ester (CHEBI:25248) |
| F390C (CHEBI:65894) is a phenols (CHEBI:33853) |
| F390C (CHEBI:65894) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| methyl (4R,4aS)-4,8-dihydroxy-6-(hydroxymethyl)-9-oxo-4,9-dihydro-4aH-xanthene-4a-carboxylate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8161679 | Reaxys |
| Citations |
|---|