EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O7 |
| Net Charge | 0 |
| Average Mass | 344.319 |
| Monoisotopic Mass | 344.08960 |
| SMILES | COC(=O)[C@]12Oc3cc(C)cc(O)c3C(=O)C1=CC=C[C@H]2OC(C)=O |
| InChI | InChI=1S/C18H16O7/c1-9-7-12(20)15-13(8-9)25-18(17(22)23-3)11(16(15)21)5-4-6-14(18)24-10(2)19/h4-8,14,20H,1-3H3/t14-,18+/m1/s1 |
| InChIKey | OOXFQLGEGVNXBG-KDOFPFPSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (9711252) | Strain: AJ117291 |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| F390B (CHEBI:65893) has role Penicillium metabolite (CHEBI:76964) |
| F390B (CHEBI:65893) has role antimicrobial agent (CHEBI:33281) |
| F390B (CHEBI:65893) has role antineoplastic agent (CHEBI:35610) |
| F390B (CHEBI:65893) is a acetate ester (CHEBI:47622) |
| F390B (CHEBI:65893) is a diester (CHEBI:51307) |
| F390B (CHEBI:65893) is a methyl ester (CHEBI:25248) |
| F390B (CHEBI:65893) is a phenols (CHEBI:33853) |
| F390B (CHEBI:65893) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| methyl (4R,4aS)-4-(acetyloxy)-8-hydroxy-6-methyl-9-oxo-4,9-dihydro-4aH-xanthene-4a-carboxylate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8160407 | Reaxys |
| Citations |
|---|