EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28O10 |
| Net Charge | 0 |
| Average Mass | 416.423 |
| Monoisotopic Mass | 416.16825 |
| SMILES | C[C@](O)(CO)[C@@H](O)COC(=O)/C=C/c1ccc(OC[C@@](C)(O)[C@H](O)CO)c(O)c1 |
| InChI | InChI=1S/C19H28O10/c1-18(26,10-21)16(24)9-28-17(25)6-4-12-3-5-14(13(22)7-12)29-11-19(2,27)15(23)8-20/h3-7,15-16,20-24,26-27H,8-11H2,1-2H3/b6-4+/t15-,16+,18+,19-/m1/s1 |
| InChIKey | GTNFLOUXEFGGSM-BSVFCNQSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Evolvulus alsinoides (ncbitaxon:439689) | whole plant (BTO:0001461) | PubMed (17473466) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | drug Any substance which when absorbed into a living organism may modify one or more of its functions. The term is generally accepted for a substance taken for a therapeutic purpose, but is also commonly used for abused substances. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| evolvoid A (CHEBI:65890) has functional parent trans-caffeic acid (CHEBI:16433) |
| evolvoid A (CHEBI:65890) has role drug (CHEBI:23888) |
| evolvoid A (CHEBI:65890) has role metabolite (CHEBI:25212) |
| evolvoid A (CHEBI:65890) is a cinnamate ester (CHEBI:36087) |
| evolvoid A (CHEBI:65890) is a polyol (CHEBI:26191) |
| IUPAC Name |
|---|
| (2S,3S)-2,3,4-trihydroxy-3-methylbutyl (2E)-3-(3-hydroxy-4-{[(2R,3R)-2,3,4-trihydroxy-2-methylbutyl]oxy}phenyl)prop-2-enoate |
| Synonym | Source |
|---|---|
| 2,3,4-trihydroxy-3-methylbutyl-3-[3-hydroxy-4-(2,3,4-trihydroxy-2-methyl-butoxy)-phenyl]-2-propenoate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11171004 | Reaxys |
| Citations |
|---|